C15H22N2O3 — CID 78150877
3-(oxan-4-ylamino)-4-pyridin-3-ylcyclopentane-1,2-diol (PubChem CID 78150877) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 3-(oxan-4-ylamino)-4-pyridin-3-ylcyclopentane-1,2-diol.
| Compound Name | 3-(oxan-4-ylamino)-4-pyridin-3-ylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 78150877 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 3-(oxan-4-ylamino)-4-pyridin-3-ylcyclopentane-1,2-diol |
| SMILES | OC1CC(c2cccnc2)C(NC2CCOCC2)C1O |
| InChI | InChI=1S/C15H22N2O3/c18-13-8-12(10-2-1-5-16-9-10)14(15(13)19)17-11-3-6-20-7-4-11/h1-2,5,9,11-15,17-19H,3-4,6-8H2 |
| InChIKey | YPYZEWMJDGRVCS-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |