About 4-bromooxane;3-bromopyridine;3-(oxan-4-yl)pyridine
4-bromooxane;3-bromopyridine;3-(oxan-4-yl)pyridine (PubChem CID 160840050) has the molecular formula C20H26Br2N2O2
and a molecular weight of 486.25 g/mol. Its IUPAC name is 4-bromooxane;3-bromopyridine;3-(oxan-4-yl)pyridine.
Molecular Properties
| Compound Name | 4-bromooxane;3-bromopyridine;3-(oxan-4-yl)pyridine |
| PubChem CID | 160840050 |
| Molecular Formula | C20H26Br2N2O2 |
| Molecular Weight | 486.25 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | 4-bromooxane;3-bromopyridine;3-(oxan-4-yl)pyridine |
| SMILES | BrC1CCOCC1.Brc1cccnc1.c1cncc(C2CCOCC2)c1 |
| InChI | InChI=1S/C10H13NO.C5H4BrN.C5H9BrO/c1-2-10(8-11-5-1)9-3-6-12-7-4-9;6-5-2-1-3-7-4-5;6-5-1-3-7-4-2-5/h1-2,5,8-9H,3-4,6-7H2;1-4H;5H,1-4H2 |
| InChIKey | SHXHSESFXUPOMF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.25 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromooxane;3-bromopyridine;3-(oxan-4-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromooxane;3-bromopyridine;3-(oxan-4-yl)pyridine?
The IUPAC name of 4-bromooxane;3-bromopyridine;3-(oxan-4-yl)pyridine (CID 160840050) is 4-bromooxane;3-bromopyridine;3-(oxan-4-yl)pyridine.
What is the SMILES notation for 4-bromooxane;3-bromopyridine;3-(oxan-4-yl)pyridine?
The canonical SMILES for 4-bromooxane;3-bromopyridine;3-(oxan-4-yl)pyridine is BrC1CCOCC1.Brc1cccnc1.c1cncc(C2CCOCC2)c1.
What is the InChIKey of 4-bromooxane;3-bromopyridine;3-(oxan-4-yl)pyridine?
The InChIKey is SHXHSESFXUPOMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO.C5H4BrN.C5H9BrO/c1-2-10(8-11-5-1)9-3-6-12-7-4-9;6-5-2-1-3-7-4-5;6-5-1-3-7-4-2-5/h1-2,5,8-9H,3-4,6-7H2;1-4H;5H,1-4H2.
What are the key properties of 4-bromooxane;3-bromopyridine;3-(oxan-4-yl)pyridine?
4-bromooxane;3-bromopyridine;3-(oxan-4-yl)pyridine has a molecular weight of 486.25 g/mol, XLogP of 5.38, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromooxane;3-bromopyridine;3-(oxan-4-yl)pyridine is sourced from PubChem (CID 160840050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).