C24H29N3O2 — CID 78152352
N,4-dibenzyl-6-tert-butyl-2-methyl-3-oxo-1,2-dihydropyrazine-5-carboxamide (PubChem CID 78152352) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is N,4-dibenzyl-6-tert-butyl-2-methyl-3-oxo-1,2-dihydropyrazine-5-carboxamide.
| Compound Name | N,4-dibenzyl-6-tert-butyl-2-methyl-3-oxo-1,2-dihydropyrazine-5-carboxamide |
|---|---|
| PubChem CID | 78152352 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N,4-dibenzyl-6-tert-butyl-2-methyl-3-oxo-1,2-dihydropyrazine-5-carboxamide |
| SMILES | CC1NC(C(C)(C)C)=C(C(=O)NCc2ccccc2)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C24H29N3O2/c1-17-23(29)27(16-19-13-9-6-10-14-19)20(21(26-17)24(2,3)4)22(28)25-15-18-11-7-5-8-12-18/h5-14,17,26H,15-16H2,1-4H3,(H,25,28) |
| InChIKey | AZVNMBGEPNHRTK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |