C17H16ClN5O2 — CID 78154827
(6-azido-3-pyridinyl)-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methanone (PubChem CID 78154827) has the molecular formula C17H16ClN5O2 and a molecular weight of 357.80 g/mol. Its IUPAC name is (6-azido-3-pyridinyl)-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methanone.
| Compound Name | (6-azido-3-pyridinyl)-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 78154827 |
| Molecular Formula | C17H16ClN5O2 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (6-azido-3-pyridinyl)-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methanone |
| SMILES | [N-]=[N+]=Nc1ccc(C(=O)N2CCC(O)(c3ccc(Cl)cc3)CC2)cn1 |
| InChI | InChI=1S/C17H16ClN5O2/c18-14-4-2-13(3-5-14)17(25)7-9-23(10-8-17)16(24)12-1-6-15(20-11-12)21-22-19/h1-6,11,25H,7-10H2 |
| InChIKey | XBPMGTYDTQYJGS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|