C8H13NOS — CID 78170091
6-methyl-3a,4,5,6,7,7a-hexahydro-1,2-benzothiazol-3-one (PubChem CID 78170091) has the molecular formula C8H13NOS and a molecular weight of 171.26 g/mol. Its IUPAC name is 6-methyl-3a,4,5,6,7,7a-hexahydro-1,2-benzothiazol-3-one.
| Compound Name | 6-methyl-3a,4,5,6,7,7a-hexahydro-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 78170091 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 6-methyl-3a,4,5,6,7,7a-hexahydro-1,2-benzothiazol-3-one |
| SMILES | CC1CCC2C(=O)NSC2C1 |
| InChI | InChI=1S/C8H13NOS/c1-5-2-3-6-7(4-5)11-9-8(6)10/h5-7H,2-4H2,1H3,(H,9,10) |
| InChIKey | KOCFSPLGQYUKIW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|