C7H11NNaOS — CID 77152194
CID 77152194 (PubChem CID 77152194) has the molecular formula C7H11NNaOS and a molecular weight of 180.23 g/mol.
| Compound Name | CID 77152194 |
|---|---|
| PubChem CID | 77152194 |
| Molecular Formula | C7H11NNaOS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | — |
| SMILES | O=C1NSC2CCCCC12.[Na] |
| InChI | InChI=1S/C7H11NOS.Na/c9-7-5-3-1-2-4-6(5)10-8-7;/h5-6H,1-4H2,(H,8,9); |
| InChIKey | ILRINEUUYRIGRE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|