C7H11NO3S — CID 166863529
(7aS)-1,1-dioxo-3a,4,5,6,7,7a-hexahydro-1,2-benzothiazol-3-one (PubChem CID 166863529) has the molecular formula C7H11NO3S and a molecular weight of 189.24 g/mol. Its IUPAC name is (7aS)-1,1-dioxo-3a,4,5,6,7,7a-hexahydro-1,2-benzothiazol-3-one.
| Compound Name | (7aS)-1,1-dioxo-3a,4,5,6,7,7a-hexahydro-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 166863529 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | (7aS)-1,1-dioxo-3a,4,5,6,7,7a-hexahydro-1,2-benzothiazol-3-one |
| SMILES | O=C1NS(=O)(=O)[C@H]2CCCCC12 |
| InChI | InChI=1S/C7H11NO3S/c9-7-5-3-1-2-4-6(5)12(10,11)8-7/h5-6H,1-4H2,(H,8,9)/t5?,6-/m0/s1 |
| InChIKey | SCIFFMCNMMSWKV-GDVGLLTNSA-N |
| XLogP | 0.00 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |