C6H10N2O3S — CID 131122587
(3aS,7aR)-1,1-dioxo-3a,4,5,6,7,7a-hexahydro-[1,2]thiazolo[4,5-b]pyridin-3-one (PubChem CID 131122587) has the molecular formula C6H10N2O3S and a molecular weight of 190.22 g/mol. Its IUPAC name is (3aS,7aR)-1,1-dioxo-3a,4,5,6,7,7a-hexahydro-[1,2]thiazolo[4,5-b]pyridin-3-one.
| Compound Name | (3aS,7aR)-1,1-dioxo-3a,4,5,6,7,7a-hexahydro-[1,2]thiazolo[4,5-b]pyridin-3-one |
|---|---|
| PubChem CID | 131122587 |
| Molecular Formula | C6H10N2O3S |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | (3aS,7aR)-1,1-dioxo-3a,4,5,6,7,7a-hexahydro-[1,2]thiazolo[4,5-b]pyridin-3-one |
| SMILES | O=C1NS(=O)(=O)[C@@H]2CCCN[C@@H]12 |
| InChI | InChI=1S/C6H10N2O3S/c9-6-5-4(2-1-3-7-5)12(10,11)8-6/h4-5,7H,1-3H2,(H,8,9)/t4-,5-/m1/s1 |
| InChIKey | KACIOJPSSPRLQD-RFZPGFLSSA-N |
| XLogP | -1.43 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |