C8H11NO2 — CID 72746062
1,2,3,4,4a,8a-hexahydropyrano[3,4-b]pyridin-8-one (PubChem CID 72746062) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 1,2,3,4,4a,8a-hexahydropyrano[3,4-b]pyridin-8-one.
| Compound Name | 1,2,3,4,4a,8a-hexahydropyrano[3,4-b]pyridin-8-one |
|---|---|
| PubChem CID | 72746062 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 1,2,3,4,4a,8a-hexahydropyrano[3,4-b]pyridin-8-one |
| SMILES | O=C1OC=CC2CCCNC12 |
| InChI | InChI=1S/C8H11NO2/c10-8-7-6(3-5-11-8)2-1-4-9-7/h3,5-7,9H,1-2,4H2 |
| InChIKey | JQUDSSLMTAVVQX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |