C9H14N2 — CID 173058087
2-pyrrolidin-2-yl-1,2-dihydropyridine (PubChem CID 173058087) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-pyrrolidin-2-yl-1,2-dihydropyridine.
| Compound Name | 2-pyrrolidin-2-yl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 173058087 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2-pyrrolidin-2-yl-1,2-dihydropyridine |
| SMILES | C1=CNC(C2CCCN2)C=C1 |
| InChI | InChI=1S/C9H14N2/c1-2-6-10-8(4-1)9-5-3-7-11-9/h1-2,4,6,8-11H,3,5,7H2 |
| InChIKey | HPKFNIXZJRXIDN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |