C5H8N2O — CID 69327135
(1R)-2,6-diazabicyclo[3.2.0]heptan-7-one (PubChem CID 69327135) has the molecular formula C5H8N2O and a molecular weight of 112.13 g/mol. Its IUPAC name is (1R)-2,6-diazabicyclo[3.2.0]heptan-7-one.
| Compound Name | (1R)-2,6-diazabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 69327135 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | (1R)-2,6-diazabicyclo[3.2.0]heptan-7-one |
| SMILES | O=C1NC2CCN[C@@H]12 |
| InChI | InChI=1S/C5H8N2O/c8-5-4-3(7-5)1-2-6-4/h3-4,6H,1-2H2,(H,7,8)/t3?,4-/m1/s1 |
| InChIKey | RSHINDBAUNILFQ-SRBOSORUSA-N |
| XLogP | -1.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |