C9H11N4O3+ — CID 78175556
8-(1-hydroxyethyl)-1,3-dimethylpurin-3-ium-2,6-dione (PubChem CID 78175556) has the molecular formula C9H11N4O3+ and a molecular weight of 223.21 g/mol. Its IUPAC name is 8-(1-hydroxyethyl)-1,3-dimethylpurin-3-ium-2,6-dione.
| Compound Name | 8-(1-hydroxyethyl)-1,3-dimethylpurin-3-ium-2,6-dione |
|---|---|
| PubChem CID | 78175556 |
| Molecular Formula | C9H11N4O3+ |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 8-(1-hydroxyethyl)-1,3-dimethylpurin-3-ium-2,6-dione |
| SMILES | CC(O)C1=NC2=[N+](C)C(=O)N(C)C(=O)C2=N1 |
| InChI | InChI=1S/C9H11N4O3/c1-4(14)6-10-5-7(11-6)12(2)9(16)13(3)8(5)15/h4,14H,1-3H3/q+1 |
| InChIKey | XBJSSTLROJVSOT-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|