C16H20N2O5S — CID 7819597
ethyl 2-[[2-(2,5-dioxopyrrolidin-1-yl)acetyl]amino]-5-ethyl-4-methylthiophene-3-carboxylate (PubChem CID 7819597) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is ethyl 2-[[2-(2,5-dioxopyrrolidin-1-yl)acetyl]amino]-5-ethyl-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(2,5-dioxopyrrolidin-1-yl)acetyl]amino]-5-ethyl-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7819597 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | ethyl 2-[[2-(2,5-dioxopyrrolidin-1-yl)acetyl]amino]-5-ethyl-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CN2C(=O)CCC2=O)sc(CC)c1C |
| InChI | InChI=1S/C16H20N2O5S/c1-4-10-9(3)14(16(22)23-5-2)15(24-10)17-11(19)8-18-12(20)6-7-13(18)21/h4-8H2,1-3H3,(H,17,19) |
| InChIKey | TYDAQXSKMRKTQR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|