C10H17N3O2 — CID 78201165
5-(piperidin-1-ylmethyl)-1,3-diazinane-2,4-dione (PubChem CID 78201165) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 5-(piperidin-1-ylmethyl)-1,3-diazinane-2,4-dione.
| Compound Name | 5-(piperidin-1-ylmethyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 78201165 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 5-(piperidin-1-ylmethyl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1NCC(CN2CCCCC2)C(=O)N1 |
| InChI | InChI=1S/C10H17N3O2/c14-9-8(6-11-10(15)12-9)7-13-4-2-1-3-5-13/h8H,1-7H2,(H2,11,12,14,15) |
| InChIKey | OJVHSTJMPZBEDF-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |