C22H32N6O4 — CID 78203049
7-(2-ethoxyethyl)-8-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-dimethyl-4,5-dihydropurine-2,6-dione (PubChem CID 78203049) has the molecular formula C22H32N6O4 and a molecular weight of 444.54 g/mol. Its IUPAC name is 7-(2-ethoxyethyl)-8-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-dimethyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 7-(2-ethoxyethyl)-8-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-dimethyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78203049 |
| Molecular Formula | C22H32N6O4 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 7-(2-ethoxyethyl)-8-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-dimethyl-4,5-dihydropurine-2,6-dione |
| SMILES | CCOCCN1C(N2CCN(c3ccc(OC)cc3)CC2)=NC2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C22H32N6O4/c1-5-32-15-14-28-18-19(24(2)22(30)25(3)20(18)29)23-21(28)27-12-10-26(11-13-27)16-6-8-17(31-4)9-7-16/h6-9,18-19H,5,10-15H2,1-4H3 |
| InChIKey | AWDGYFOTHALTJC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|