C19H19BrFNO4 — CID 78203138
7-bromo-1-(3-fluorophenyl)-2-(2-hydroxyethyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78203138) has the molecular formula C19H19BrFNO4 and a molecular weight of 424.27 g/mol. Its IUPAC name is 7-bromo-1-(3-fluorophenyl)-2-(2-hydroxyethyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-1-(3-fluorophenyl)-2-(2-hydroxyethyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78203138 |
| Molecular Formula | C19H19BrFNO4 |
| Molecular Weight | 424.27 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 7-bromo-1-(3-fluorophenyl)-2-(2-hydroxyethyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | O=C1C2=C(OC3CCC(Br)CC13)C(=O)N(CCO)C2c1cccc(F)c1 |
| InChI | InChI=1S/C19H19BrFNO4/c20-11-4-5-14-13(9-11)17(24)15-16(10-2-1-3-12(21)8-10)22(6-7-23)19(25)18(15)26-14/h1-3,8,11,13-14,16,23H,4-7,9H2 |
| InChIKey | CTSVXEQNUOSQBG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|