C20H33N6O4+ — CID 78203383
ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-pentyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate (PubChem CID 78203383) has the molecular formula C20H33N6O4+ and a molecular weight of 421.52 g/mol. Its IUPAC name is ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-pentyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-pentyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 78203383 |
| Molecular Formula | C20H33N6O4+ |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-pentyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate |
| SMILES | CCCCC[N+]1=C(CN2CCN(C(=O)OCC)CC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C20H33N6O4/c1-5-7-8-9-26-15(14-24-10-12-25(13-11-24)20(29)30-6-2)21-17-16(26)18(27)23(4)19(28)22(17)3/h16H,5-14H2,1-4H3/q+1 |
| InChIKey | BDDKMIAIGJOXAA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 88.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|