C9H12O5S — CID 78210178
3-(2-methylprop-2-enoyl)-1,1-dioxothiolane-2-carboxylic acid (PubChem CID 78210178) has the molecular formula C9H12O5S and a molecular weight of 232.26 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoyl)-1,1-dioxothiolane-2-carboxylic acid.
| Compound Name | 3-(2-methylprop-2-enoyl)-1,1-dioxothiolane-2-carboxylic acid |
|---|---|
| PubChem CID | 78210178 |
| Molecular Formula | C9H12O5S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 3-(2-methylprop-2-enoyl)-1,1-dioxothiolane-2-carboxylic acid |
| SMILES | C=C(C)C(=O)C1CCS(=O)(=O)C1C(=O)O |
| InChI | InChI=1S/C9H12O5S/c1-5(2)7(10)6-3-4-15(13,14)8(6)9(11)12/h6,8H,1,3-4H2,2H3,(H,11,12) |
| InChIKey | VHOKMXZQEFRKDR-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|