About 1-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)piperidin-1-ium-4-carboxylic acid
1-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)piperidin-1-ium-4-carboxylic acid (PubChem CID 78235903) has the molecular formula C13H16N5O4+
and a molecular weight of 306.30 g/mol. Its IUPAC name is 1-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)piperidin-1-ium-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)piperidin-1-ium-4-carboxylic acid |
| PubChem CID | 78235903 |
| Molecular Formula | C13H16N5O4+ |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)piperidin-1-ium-4-carboxylic acid |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)=NC(=[N+]1CCC(C(=O)O)CC1)N=2 |
| InChI | InChI=1S/C13H15N5O4/c1-16-9-8(10(19)17(2)13(16)22)14-12(15-9)18-5-3-7(4-6-18)11(20)21/h7H,3-6H2,1-2H3/p+1 |
| InChIKey | DAVXHRPQBFSMFU-UHFFFAOYSA-O |
| XLogP | -2.80 |
| TPSA | 109.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)piperidin-1-ium-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)piperidin-1-ium-4-carboxylic acid?
The IUPAC name of 1-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)piperidin-1-ium-4-carboxylic acid (CID 78235903) is 1-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)piperidin-1-ium-4-carboxylic acid.
What is the SMILES notation for 1-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)piperidin-1-ium-4-carboxylic acid?
The canonical SMILES for 1-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)piperidin-1-ium-4-carboxylic acid is Cn1c(=O)c2c(n(C)c1=O)=NC(=[N+]1CCC(C(=O)O)CC1)N=2.
What is the InChIKey of 1-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)piperidin-1-ium-4-carboxylic acid?
The InChIKey is DAVXHRPQBFSMFU-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H15N5O4/c1-16-9-8(10(19)17(2)13(16)22)14-12(15-9)18-5-3-7(4-6-18)11(20)21/h7H,3-6H2,1-2H3/p+1.
What are the key properties of 1-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)piperidin-1-ium-4-carboxylic acid?
1-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)piperidin-1-ium-4-carboxylic acid has a molecular weight of 306.30 g/mol, XLogP of -2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dimethyl-2,6-dioxopurin-8-ylidene)piperidin-1-ium-4-carboxylic acid is sourced from PubChem (CID 78235903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).