C13H19N4O4+ — CID 78070185
4-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)-2-ethylbutanoic acid (PubChem CID 78070185) has the molecular formula C13H19N4O4+ and a molecular weight of 295.32 g/mol. Its IUPAC name is 4-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)-2-ethylbutanoic acid.
| Compound Name | 4-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 78070185 |
| Molecular Formula | C13H19N4O4+ |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 4-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)-2-ethylbutanoic acid |
| SMILES | CCC(CCN1C(=O)C2C(=NC=[N+]2C)N(C)C1=O)C(=O)O |
| InChI | InChI=1S/C13H18N4O4/c1-4-8(12(19)20)5-6-17-11(18)9-10(14-7-15(9)2)16(3)13(17)21/h7-9H,4-6H2,1-3H3/p+1 |
| InChIKey | XKMVMBFCWLDYTD-UHFFFAOYSA-O |
| XLogP | -0.17 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|