4-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoic acid

C11H15N4O4+ — CID 78169596

IUPAC4-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoic acid
SMILESCN1C(=O)C2C(=NC=[N+]2CCCC(=O)O)N(C)C1=O
InChIInChI=1S/C11H14N4O4/c1-13-9-8(10(18)14(2)11(13)19)15(6-12-9)5-3-4-7(16)17/h6,8H,3-5H2,1-2H3/p+1
InChIKeyMINVCRPVASFUMH-UHFFFAOYSA-O
MW267.26 g/mol
LogP-0.80
Rot. Bonds4

About 4-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoic acid

4-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoic acid (PubChem CID 78169596) has the molecular formula C11H15N4O4+ and a molecular weight of 267.26 g/mol. Its IUPAC name is 4-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoic acid.

Molecular Properties

Compound Name4-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoic acid
PubChem CID78169596
Molecular FormulaC11H15N4O4+
Molecular Weight267.26 g/mol
Exact Mass267.11
IUPAC Name4-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoic acid
SMILESCN1C(=O)C2C(=NC=[N+]2CCCC(=O)O)N(C)C1=O
InChIInChI=1S/C11H14N4O4/c1-13-9-8(10(18)14(2)11(13)19)15(6-12-9)5-3-4-7(16)17/h6,8H,3-5H2,1-2H3/p+1
InChIKeyMINVCRPVASFUMH-UHFFFAOYSA-O
XLogP-0.80
TPSA93.29 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.26
LogP ≤ 5-0.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 4-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoic acid?
The IUPAC name of 4-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoic acid (CID 78169596) is 4-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoic acid.
What is the SMILES notation for 4-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoic acid?
The canonical SMILES for 4-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoic acid is CN1C(=O)C2C(=NC=[N+]2CCCC(=O)O)N(C)C1=O.
What is the InChIKey of 4-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoic acid?
The InChIKey is MINVCRPVASFUMH-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H14N4O4/c1-13-9-8(10(18)14(2)11(13)19)15(6-12-9)5-3-4-7(16)17/h6,8H,3-5H2,1-2H3/p+1.
What are the key properties of 4-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoic acid?
4-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoic acid has a molecular weight of 267.26 g/mol, XLogP of -0.80, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoic acid is sourced from PubChem (CID 78169596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).