C9H10N4NaO4+ — CID 74085567
sodium 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetate (PubChem CID 74085567) has the molecular formula C9H10N4NaO4+ and a molecular weight of 261.19 g/mol. Its IUPAC name is sodium 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetate.
| Compound Name | sodium 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetate |
|---|---|
| PubChem CID | 74085567 |
| Molecular Formula | C9H10N4NaO4+ |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | sodium 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetate |
| SMILES | CN1C(=O)C2C(=NC=[N+]2CC(=O)[O-])N(C)C1=O.[Na+] |
| InChI | InChI=1S/C9H10N4O4.Na/c1-11-7-6(8(16)12(2)9(11)17)13(4-10-7)3-5(14)15;/h4,6H,3H2,1-2H3;/q;+1 |
| InChIKey | JGZBPRBXRXTOAK-UHFFFAOYSA-N |
| XLogP | -5.91 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | -5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|