C13H18BrN4O4+ — CID 76845752
ethyl 4-(8-bromo-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoate (PubChem CID 76845752) has the molecular formula C13H18BrN4O4+ and a molecular weight of 374.22 g/mol. Its IUPAC name is ethyl 4-(8-bromo-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoate.
| Compound Name | ethyl 4-(8-bromo-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoate |
|---|---|
| PubChem CID | 76845752 |
| Molecular Formula | C13H18BrN4O4+ |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | ethyl 4-(8-bromo-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)butanoate |
| SMILES | CCOC(=O)CCC[N+]1=C(Br)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C13H18BrN4O4/c1-4-22-8(19)6-5-7-18-9-10(15-12(18)14)16(2)13(21)17(3)11(9)20/h9H,4-7H2,1-3H3/q+1 |
| InChIKey | RYXWZYNEQDCNCM-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|