C12H14BrN4O5+ — CID 75608988
ethyl 3-(8-bromo-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)-2-oxopropanoate (PubChem CID 75608988) has the molecular formula C12H14BrN4O5+ and a molecular weight of 374.17 g/mol. Its IUPAC name is ethyl 3-(8-bromo-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)-2-oxopropanoate.
| Compound Name | ethyl 3-(8-bromo-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)-2-oxopropanoate |
|---|---|
| PubChem CID | 75608988 |
| Molecular Formula | C12H14BrN4O5+ |
| Molecular Weight | 374.17 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | ethyl 3-(8-bromo-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)-2-oxopropanoate |
| SMILES | CCOC(=O)C(=O)C[N+]1=C(Br)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C12H14BrN4O5/c1-4-22-10(20)6(18)5-17-7-8(14-11(17)13)15(2)12(21)16(3)9(7)19/h7H,4-5H2,1-3H3/q+1 |
| InChIKey | DPGZSVCPJBBRCQ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.17 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|