C12H14BrN4O6+ — CID 78202553
methyl 2-[8-bromo-7-(2-methoxy-2-oxoethyl)-3-methyl-2,6-dioxo-5H-purin-7-ium-1-yl]acetate (PubChem CID 78202553) has the molecular formula C12H14BrN4O6+ and a molecular weight of 390.17 g/mol. Its IUPAC name is methyl 2-[8-bromo-7-(2-methoxy-2-oxoethyl)-3-methyl-2,6-dioxo-5H-purin-7-ium-1-yl]acetate.
| Compound Name | methyl 2-[8-bromo-7-(2-methoxy-2-oxoethyl)-3-methyl-2,6-dioxo-5H-purin-7-ium-1-yl]acetate |
|---|---|
| PubChem CID | 78202553 |
| Molecular Formula | C12H14BrN4O6+ |
| Molecular Weight | 390.17 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | methyl 2-[8-bromo-7-(2-methoxy-2-oxoethyl)-3-methyl-2,6-dioxo-5H-purin-7-ium-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)C2C(=NC(Br)=[N+]2CC(=O)OC)N(C)C1=O |
| InChI | InChI=1S/C12H14BrN4O6/c1-15-9-8(16(11(13)14-9)4-6(18)22-2)10(20)17(12(15)21)5-7(19)23-3/h8H,4-5H2,1-3H3/q+1 |
| InChIKey | VNNBAOWGONQVGT-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 108.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.17 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|