C11H16BrN4O2+ — CID 74526080
8-bromo-1-ethyl-3-methyl-7-propan-2-yl-5H-purin-7-ium-2,6-dione (PubChem CID 74526080) has the molecular formula C11H16BrN4O2+ and a molecular weight of 316.18 g/mol. Its IUPAC name is 8-bromo-1-ethyl-3-methyl-7-propan-2-yl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-bromo-1-ethyl-3-methyl-7-propan-2-yl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74526080 |
| Molecular Formula | C11H16BrN4O2+ |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 8-bromo-1-ethyl-3-methyl-7-propan-2-yl-5H-purin-7-ium-2,6-dione |
| SMILES | CCN1C(=O)C2C(=NC(Br)=[N+]2C(C)C)N(C)C1=O |
| InChI | InChI=1S/C11H16BrN4O2/c1-5-15-9(17)7-8(14(4)11(15)18)13-10(12)16(7)6(2)3/h6-7H,5H2,1-4H3/q+1 |
| InChIKey | LVKBGCLFTWGPFJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|