C10H14BrN4O2+ — CID 74526078
8-bromo-1,7-diethyl-3-methyl-5H-purin-7-ium-2,6-dione (PubChem CID 74526078) has the molecular formula C10H14BrN4O2+ and a molecular weight of 302.15 g/mol. Its IUPAC name is 8-bromo-1,7-diethyl-3-methyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-bromo-1,7-diethyl-3-methyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74526078 |
| Molecular Formula | C10H14BrN4O2+ |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 8-bromo-1,7-diethyl-3-methyl-5H-purin-7-ium-2,6-dione |
| SMILES | CCN1C(=O)C2C(=NC(Br)=[N+]2CC)N(C)C1=O |
| InChI | InChI=1S/C10H14BrN4O2/c1-4-14-6-7(12-9(14)11)13(3)10(17)15(5-2)8(6)16/h6H,4-5H2,1-3H3/q+1 |
| InChIKey | KNPHNZQMDIYHPW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|