C11H15N4O4+ — CID 77068680
ethyl 2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)acetate (PubChem CID 77068680) has the molecular formula C11H15N4O4+ and a molecular weight of 267.26 g/mol. Its IUPAC name is ethyl 2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)acetate.
| Compound Name | ethyl 2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)acetate |
|---|---|
| PubChem CID | 77068680 |
| Molecular Formula | C11H15N4O4+ |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | ethyl 2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)C2C(=NC=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C11H15N4O4/c1-4-19-7(16)5-15-10(17)8-9(12-6-13(8)2)14(3)11(15)18/h6,8H,4-5H2,1-3H3/q+1 |
| InChIKey | MVRYRYSTEDTWDA-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|