C13H19N4O4+ — CID 77068674
ethyl 4-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)butanoate (PubChem CID 77068674) has the molecular formula C13H19N4O4+ and a molecular weight of 295.32 g/mol. Its IUPAC name is ethyl 4-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)butanoate.
| Compound Name | ethyl 4-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)butanoate |
|---|---|
| PubChem CID | 77068674 |
| Molecular Formula | C13H19N4O4+ |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | ethyl 4-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)butanoate |
| SMILES | CCOC(=O)CCCN1C(=O)C2C(=NC=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C13H19N4O4/c1-4-21-9(18)6-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20/h8,10H,4-7H2,1-3H3/q+1 |
| InChIKey | HPNDTEDIHVMZDK-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|