C11H14ClN4O4+ — CID 78204538
ethyl 2-(8-chloro-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetate (PubChem CID 78204538) has the molecular formula C11H14ClN4O4+ and a molecular weight of 301.71 g/mol. Its IUPAC name is ethyl 2-(8-chloro-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetate.
| Compound Name | ethyl 2-(8-chloro-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetate |
|---|---|
| PubChem CID | 78204538 |
| Molecular Formula | C11H14ClN4O4+ |
| Molecular Weight | 301.71 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | ethyl 2-(8-chloro-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetate |
| SMILES | CCOC(=O)C[N+]1=C(Cl)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C11H14ClN4O4/c1-4-20-6(17)5-16-7-8(13-10(16)12)14(2)11(19)15(3)9(7)18/h7H,4-5H2,1-3H3/q+1 |
| InChIKey | XIRLFRAQXKPTCE-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.71 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|