C15H23N4O4+ — CID 73194774
6-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)hexan-2-yl acetate (PubChem CID 73194774) has the molecular formula C15H23N4O4+ and a molecular weight of 323.37 g/mol. Its IUPAC name is 6-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)hexan-2-yl acetate.
| Compound Name | 6-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)hexan-2-yl acetate |
|---|---|
| PubChem CID | 73194774 |
| Molecular Formula | C15H23N4O4+ |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 6-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)hexan-2-yl acetate |
| SMILES | CC(=O)OC(C)CCCCN1C(=O)C2C(=NC=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C15H23N4O4/c1-10(23-11(2)20)7-5-6-8-19-14(21)12-13(16-9-17(12)3)18(4)15(19)22/h9-10,12H,5-8H2,1-4H3/q+1 |
| InChIKey | QAHLTTISMXDEQQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|