C13H18N5O4+ — CID 75118179
ethyl 2-(2,4-dimethyl-1,3-dioxo-8,9a-dihydro-7H-purino[7,8-a]imidazol-6-ium-6-yl)acetate (PubChem CID 75118179) has the molecular formula C13H18N5O4+ and a molecular weight of 308.32 g/mol. Its IUPAC name is ethyl 2-(2,4-dimethyl-1,3-dioxo-8,9a-dihydro-7H-purino[7,8-a]imidazol-6-ium-6-yl)acetate.
| Compound Name | ethyl 2-(2,4-dimethyl-1,3-dioxo-8,9a-dihydro-7H-purino[7,8-a]imidazol-6-ium-6-yl)acetate |
|---|---|
| PubChem CID | 75118179 |
| Molecular Formula | C13H18N5O4+ |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | ethyl 2-(2,4-dimethyl-1,3-dioxo-8,9a-dihydro-7H-purino[7,8-a]imidazol-6-ium-6-yl)acetate |
| SMILES | CCOC(=O)C[N+]1=C2N=C3C(C(=O)N(C)C(=O)N3C)N2CC1 |
| InChI | InChI=1S/C13H18N5O4/c1-4-22-8(19)7-17-5-6-18-9-10(14-12(17)18)15(2)13(21)16(3)11(9)20/h9H,4-7H2,1-3H3/q+1 |
| InChIKey | UQKHCVQLOOIPEG-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|