C16H27N6O3+ — CID 74562626
7-(2-methoxyethyl)-1,3-dimethyl-8-[(4-methylpiperazin-1-yl)methyl]-5H-purin-7-ium-2,6-dione (PubChem CID 74562626) has the molecular formula C16H27N6O3+ and a molecular weight of 351.43 g/mol. Its IUPAC name is 7-(2-methoxyethyl)-1,3-dimethyl-8-[(4-methylpiperazin-1-yl)methyl]-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-(2-methoxyethyl)-1,3-dimethyl-8-[(4-methylpiperazin-1-yl)methyl]-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74562626 |
| Molecular Formula | C16H27N6O3+ |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 7-(2-methoxyethyl)-1,3-dimethyl-8-[(4-methylpiperazin-1-yl)methyl]-5H-purin-7-ium-2,6-dione |
| SMILES | COCC[N+]1=C(CN2CCN(C)CC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C16H27N6O3/c1-18-5-7-21(8-6-18)11-12-17-14-13(22(12)9-10-25-4)15(23)20(3)16(24)19(14)2/h13H,5-11H2,1-4H3/q+1 |
| InChIKey | SPXUXXJGNSKWIU-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|