C19H31N6O4+ — CID 78203211
ethyl 4-[(7-butyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate (PubChem CID 78203211) has the molecular formula C19H31N6O4+ and a molecular weight of 407.50 g/mol. Its IUPAC name is ethyl 4-[(7-butyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(7-butyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 78203211 |
| Molecular Formula | C19H31N6O4+ |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | ethyl 4-[(7-butyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate |
| SMILES | CCCC[N+]1=C(CN2CCN(C(=O)OCC)CC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C19H31N6O4/c1-5-7-8-25-14(13-23-9-11-24(12-10-23)19(28)29-6-2)20-16-15(25)17(26)22(4)18(27)21(16)3/h15H,5-13H2,1-4H3/q+1 |
| InChIKey | BJGZYSXLYDQLDZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 88.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|