C10H14N5O4+ — CID 73187981
3-(8-amino-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanoic acid (PubChem CID 73187981) has the molecular formula C10H14N5O4+ and a molecular weight of 268.25 g/mol. Its IUPAC name is 3-(8-amino-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanoic acid.
| Compound Name | 3-(8-amino-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanoic acid |
|---|---|
| PubChem CID | 73187981 |
| Molecular Formula | C10H14N5O4+ |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-(8-amino-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)propanoic acid |
| SMILES | CN1C(=O)C2C(=NC(N)=[N+]2CCC(=O)O)N(C)C1=O |
| InChI | InChI=1S/C10H13N5O4/c1-13-7-6(8(18)14(2)10(13)19)15(9(11)12-7)4-3-5(16)17/h6,11H,3-4H2,1-2H3,(H,16,17)/p+1 |
| InChIKey | KDENDFWKSGBPDB-UHFFFAOYSA-O |
| XLogP | -1.91 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|