C16H26N4O4 — CID 74570315
3-(3,7-dibutyl-2,6-dioxo-4,5-dihydropurin-8-yl)propanoic acid (PubChem CID 74570315) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-(3,7-dibutyl-2,6-dioxo-4,5-dihydropurin-8-yl)propanoic acid.
| Compound Name | 3-(3,7-dibutyl-2,6-dioxo-4,5-dihydropurin-8-yl)propanoic acid |
|---|---|
| PubChem CID | 74570315 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 3-(3,7-dibutyl-2,6-dioxo-4,5-dihydropurin-8-yl)propanoic acid |
| SMILES | CCCCN1C(=O)NC(=O)C2C1N=C(CCC(=O)O)N2CCCC |
| InChI | InChI=1S/C16H26N4O4/c1-3-5-9-19-11(7-8-12(21)22)17-14-13(19)15(23)18-16(24)20(14)10-6-4-2/h13-14H,3-10H2,1-2H3,(H,21,22)(H,18,23,24) |
| InChIKey | ASHNXRACCCPGRW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |