C9H10ClN4O4+ — CID 76844562
2-(8-chloro-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid (PubChem CID 76844562) has the molecular formula C9H10ClN4O4+ and a molecular weight of 273.66 g/mol. Its IUPAC name is 2-(8-chloro-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid.
| Compound Name | 2-(8-chloro-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid |
|---|---|
| PubChem CID | 76844562 |
| Molecular Formula | C9H10ClN4O4+ |
| Molecular Weight | 273.66 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 2-(8-chloro-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid |
| SMILES | CN1C(=O)C2C(=NC(Cl)=[N+]2CC(=O)O)N(C)C1=O |
| InChI | InChI=1S/C9H9ClN4O4/c1-12-6-5(7(17)13(2)9(12)18)14(3-4(15)16)8(10)11-6/h5H,3H2,1-2H3/p+1 |
| InChIKey | CEEKHZQQZPMEMO-UHFFFAOYSA-O |
| XLogP | -1.02 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.66 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|