C13H18N5O5+ — CID 74776526
2-(1,3-dimethyl-8-morpholin-4-ium-4-ylidene-2,6-dioxo-5H-purin-7-yl)acetic acid (PubChem CID 74776526) has the molecular formula C13H18N5O5+ and a molecular weight of 324.32 g/mol. Its IUPAC name is 2-(1,3-dimethyl-8-morpholin-4-ium-4-ylidene-2,6-dioxo-5H-purin-7-yl)acetic acid.
| Compound Name | 2-(1,3-dimethyl-8-morpholin-4-ium-4-ylidene-2,6-dioxo-5H-purin-7-yl)acetic acid |
|---|---|
| PubChem CID | 74776526 |
| Molecular Formula | C13H18N5O5+ |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-(1,3-dimethyl-8-morpholin-4-ium-4-ylidene-2,6-dioxo-5H-purin-7-yl)acetic acid |
| SMILES | CN1C(=O)C2C(=NC(=[N+]3CCOCC3)N2CC(=O)O)N(C)C1=O |
| InChI | InChI=1S/C13H17N5O5/c1-15-10-9(11(21)16(2)13(15)22)18(7-8(19)20)12(14-10)17-3-5-23-6-4-17/h9H,3-7H2,1-2H3/p+1 |
| InChIKey | VIOATCDVZHXGLL-UHFFFAOYSA-O |
| XLogP | -1.92 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|