C26H33FN8O4 — CID 78243756
tert-butyl 4-[4-[4-amino-3-(4-fluoro-3-nitrophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]piperazine-1-carboxylate (PubChem CID 78243756) has the molecular formula C26H33FN8O4 and a molecular weight of 540.60 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-amino-3-(4-fluoro-3-nitrophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[4-amino-3-(4-fluoro-3-nitrophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 78243756 |
| Molecular Formula | C26H33FN8O4 |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | tert-butyl 4-[4-[4-amino-3-(4-fluoro-3-nitrophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C2CCC(n3nc(-c4ccc(F)c([N+](=O)[O-])c4)c4c(N)ncnc43)CC2)CC1 |
| InChI | InChI=1S/C26H33FN8O4/c1-26(2,3)39-25(36)33-12-10-32(11-13-33)17-5-7-18(8-6-17)34-24-21(23(28)29-15-30-24)22(31-34)16-4-9-19(27)20(14-16)35(37)38/h4,9,14-15,17-18H,5-8,10-13H2,1-3H3,(H2,28,29,30) |
| InChIKey | NNTFWFMSFJPHLU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 145.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|