C23H29FN8O4 — CID 78243757
tert-butyl N-[2-[4-[4-amino-3-(4-fluoro-3-nitrophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]ethyl]carbamate (PubChem CID 78243757) has the molecular formula C23H29FN8O4 and a molecular weight of 500.54 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[4-amino-3-(4-fluoro-3-nitrophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[4-amino-3-(4-fluoro-3-nitrophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 78243757 |
| Molecular Formula | C23H29FN8O4 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | tert-butyl N-[2-[4-[4-amino-3-(4-fluoro-3-nitrophenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN1CCC(n2nc(-c3ccc(F)c([N+](=O)[O-])c3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C23H29FN8O4/c1-23(2,3)36-22(33)26-8-11-30-9-6-15(7-10-30)31-21-18(20(25)27-13-28-21)19(29-31)14-4-5-16(24)17(12-14)32(34)35/h4-5,12-13,15H,6-11H2,1-3H3,(H,26,33)(H2,25,27,28) |
| InChIKey | ZPSJHVUAEBBOCN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 154.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|