C25H24BrNO5 — CID 78261465
2-benzyl-1-(3-bromo-4-hydroxy-5-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78261465) has the molecular formula C25H24BrNO5 and a molecular weight of 498.37 g/mol. Its IUPAC name is 2-benzyl-1-(3-bromo-4-hydroxy-5-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-benzyl-1-(3-bromo-4-hydroxy-5-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78261465 |
| Molecular Formula | C25H24BrNO5 |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | 2-benzyl-1-(3-bromo-4-hydroxy-5-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COc1cc(C2C3=C(OC4CCCCC4C3=O)C(=O)N2Cc2ccccc2)cc(Br)c1O |
| InChI | InChI=1S/C25H24BrNO5/c1-31-19-12-15(11-17(26)23(19)29)21-20-22(28)16-9-5-6-10-18(16)32-24(20)25(30)27(21)13-14-7-3-2-4-8-14/h2-4,7-8,11-12,16,18,21,29H,5-6,9-10,13H2,1H3 |
| InChIKey | OKSHJQBPVYNTRX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |