C17H26N3O2+ — CID 7831379
[1-[(benzoylcarbamoylamino)methyl]cyclohexyl]-dimethylazanium (PubChem CID 7831379) has the molecular formula C17H26N3O2+ and a molecular weight of 304.41 g/mol. Its IUPAC name is [1-[(benzoylcarbamoylamino)methyl]cyclohexyl]-dimethylazanium.
| Compound Name | [1-[(benzoylcarbamoylamino)methyl]cyclohexyl]-dimethylazanium |
|---|---|
| PubChem CID | 7831379 |
| Molecular Formula | C17H26N3O2+ |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | [1-[(benzoylcarbamoylamino)methyl]cyclohexyl]-dimethylazanium |
| SMILES | C[NH+](C)C1(CNC(=O)NC(=O)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C17H25N3O2/c1-20(2)17(11-7-4-8-12-17)13-18-16(22)19-15(21)14-9-5-3-6-10-14/h3,5-6,9-10H,4,7-8,11-13H2,1-2H3,(H2,18,19,21,22)/p+1 |
| InChIKey | ZDYLFAOURAOWDH-UHFFFAOYSA-O |
| XLogP | 0.97 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |