C24H31N2O3+ — CID 7696515
[1-[[[2-(4-benzoylphenoxy)acetyl]amino]methyl]cyclohexyl]-dimethylazanium (PubChem CID 7696515) has the molecular formula C24H31N2O3+ and a molecular weight of 395.52 g/mol. Its IUPAC name is [1-[[[2-(4-benzoylphenoxy)acetyl]amino]methyl]cyclohexyl]-dimethylazanium.
| Compound Name | [1-[[[2-(4-benzoylphenoxy)acetyl]amino]methyl]cyclohexyl]-dimethylazanium |
|---|---|
| PubChem CID | 7696515 |
| Molecular Formula | C24H31N2O3+ |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | [1-[[[2-(4-benzoylphenoxy)acetyl]amino]methyl]cyclohexyl]-dimethylazanium |
| SMILES | C[NH+](C)C1(CNC(=O)COc2ccc(C(=O)c3ccccc3)cc2)CCCCC1 |
| InChI | InChI=1S/C24H30N2O3/c1-26(2)24(15-7-4-8-16-24)18-25-22(27)17-29-21-13-11-20(12-14-21)23(28)19-9-5-3-6-10-19/h3,5-6,9-14H,4,7-8,15-18H2,1-2H3,(H,25,27)/p+1 |
| InChIKey | OTIRUMHFNSKCSQ-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |