C21H27N2O3+ — CID 9315010
2-[[2-(4-benzoylphenoxy)acetyl]amino]ethyl-diethylazanium (PubChem CID 9315010) has the molecular formula C21H27N2O3+ and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-[[2-(4-benzoylphenoxy)acetyl]amino]ethyl-diethylazanium.
| Compound Name | 2-[[2-(4-benzoylphenoxy)acetyl]amino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 9315010 |
| Molecular Formula | C21H27N2O3+ |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 2-[[2-(4-benzoylphenoxy)acetyl]amino]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCNC(=O)COc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H26N2O3/c1-3-23(4-2)15-14-22-20(24)16-26-19-12-10-18(11-13-19)21(25)17-8-6-5-7-9-17/h5-13H,3-4,14-16H2,1-2H3,(H,22,24)/p+1 |
| InChIKey | MHAKOUIMSUSMQZ-UHFFFAOYSA-O |
| XLogP | 1.34 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |