C20H17FN6O4S — CID 78315434
6-[[4-(4-fluorophenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-1,3-diazinane-2,4-dione (PubChem CID 78315434) has the molecular formula C20H17FN6O4S and a molecular weight of 456.46 g/mol. Its IUPAC name is 6-[[4-(4-fluorophenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-1,3-diazinane-2,4-dione.
| Compound Name | 6-[[4-(4-fluorophenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 78315434 |
| Molecular Formula | C20H17FN6O4S |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 6-[[4-(4-fluorophenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CC(Cc2nnc(SCc3ccc([N+](=O)[O-])cc3)n2-c2ccc(F)cc2)NC(=O)N1 |
| InChI | InChI=1S/C20H17FN6O4S/c21-13-3-7-15(8-4-13)26-17(9-14-10-18(28)23-19(29)22-14)24-25-20(26)32-11-12-1-5-16(6-2-12)27(30)31/h1-8,14H,9-11H2,(H2,22,23,28,29) |
| InChIKey | JBOOMXMACQSIHO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|