C19H18FN7O4S — CID 78345295
2-[[5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 78345295) has the molecular formula C19H18FN7O4S and a molecular weight of 459.46 g/mol. Its IUPAC name is 2-[[5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[[5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 78345295 |
| Molecular Formula | C19H18FN7O4S |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 2-[[5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CSc2nnc(CC3CC(=O)NC(=O)N3)n2-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C19H18FN7O4S/c1-10-6-14(26-31-10)22-17(29)9-32-19-25-24-15(7-12-8-16(28)23-18(30)21-12)27(19)13-4-2-11(20)3-5-13/h2-6,12H,7-9H2,1H3,(H,22,26,29)(H2,21,23,28,30) |
| InChIKey | NNGDNKUIODEFNI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 144.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |