C19H19N7O3S2 — CID 78343708
2-[[5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 78343708) has the molecular formula C19H19N7O3S2 and a molecular weight of 457.54 g/mol. Its IUPAC name is 2-[[5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[[5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 78343708 |
| Molecular Formula | C19H19N7O3S2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 2-[[5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1cccc(-n2c(CC3CC(=O)NC(=O)N3)nnc2SCC(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C19H19N7O3S2/c1-11-3-2-4-13(7-11)26-14(8-12-9-15(27)22-17(29)21-12)24-25-19(26)31-10-16(28)23-18-20-5-6-30-18/h2-7,12H,8-10H2,1H3,(H,20,23,28)(H2,21,22,27,29) |
| InChIKey | FKIGLBKPDZLQOR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |