C20H21N7O4S2 — CID 78347999
2-[[5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-4-(3-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 78347999) has the molecular formula C20H21N7O4S2 and a molecular weight of 487.57 g/mol. Its IUPAC name is 2-[[5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-4-(3-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[[5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-4-(3-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 78347999 |
| Molecular Formula | C20H21N7O4S2 |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 2-[[5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-4-(3-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | COc1cccc(-n2c(CC3CC(=O)NC(=O)N3)nnc2SCC(=O)Nc2nc(C)cs2)c1 |
| InChI | InChI=1S/C20H21N7O4S2/c1-11-9-32-19(21-11)24-17(29)10-33-20-26-25-15(6-12-7-16(28)23-18(30)22-12)27(20)13-4-3-5-14(8-13)31-2/h3-5,8-9,12H,6-7,10H2,1-2H3,(H,21,24,29)(H2,22,23,28,30) |
| InChIKey | YGUMCMCJJPSZKK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 140.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |