C24H26N6O4S — CID 78352436
2-[[4-(2,5-dimethylphenyl)-5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxyphenyl)acetamide (PubChem CID 78352436) has the molecular formula C24H26N6O4S and a molecular weight of 494.58 g/mol. Its IUPAC name is 2-[[4-(2,5-dimethylphenyl)-5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[[4-(2,5-dimethylphenyl)-5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 78352436 |
| Molecular Formula | C24H26N6O4S |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 2-[[4-(2,5-dimethylphenyl)-5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CSc2nnc(CC3CC(=O)NC(=O)N3)n2-c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C24H26N6O4S/c1-14-7-8-15(2)19(9-14)30-20(11-17-12-21(31)27-23(33)26-17)28-29-24(30)35-13-22(32)25-16-5-4-6-18(10-16)34-3/h4-10,17H,11-13H2,1-3H3,(H,25,32)(H2,26,27,31,33) |
| InChIKey | ZJSFZOSSLZCTLI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |