C21H23N7O4S — CID 78375250
2-[[4-(2,5-dimethylphenyl)-5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 78375250) has the molecular formula C21H23N7O4S and a molecular weight of 469.53 g/mol. Its IUPAC name is 2-[[4-(2,5-dimethylphenyl)-5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[[4-(2,5-dimethylphenyl)-5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 78375250 |
| Molecular Formula | C21H23N7O4S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 2-[[4-(2,5-dimethylphenyl)-5-[(2,6-dioxo-1,3-diazinan-4-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1ccc(C)c(-n2c(CC3CC(=O)NC(=O)N3)nnc2SCC(=O)Nc2cc(C)on2)c1 |
| InChI | InChI=1S/C21H23N7O4S/c1-11-4-5-12(2)15(6-11)28-17(8-14-9-18(29)24-20(31)22-14)25-26-21(28)33-10-19(30)23-16-7-13(3)32-27-16/h4-7,14H,8-10H2,1-3H3,(H,23,27,30)(H2,22,24,29,31) |
| InChIKey | IVUBLAQRQSUJIV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 144.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |